CAS 2973747-89-4 appears in our catalog under these names: DHX9–IN–1, DHX9-IN-1, 98%, 98%, DHX9-IN-1, 98.33%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mM (in 1ml dmso), 1 mg, 100 mg, 50 mg, 5 mg, 10 mg.
5-[5-(3,3-difluoroazetidin-1-yl)-2-pyridinyl]-N-[3-(methanesulfonamido)phenyl]-1-methylpyrrole-3-carboxamide (CAS 2973747-89-4) is a chemical compound with the molecular formula C21H21F2N5O3S and a molecular weight of 461.5 g/mol. IUPAC name: 5-[5-(3,3-difluoroazetidin-1-yl)-2-pyridinyl]-N-[3-(methanesulfonamido)phenyl]-1-methylpyrrole-3-carboxamide. InChIKey: NFDWKTIXFFIEAC-UHFFFAOYSA-N.
| Molecular formula | C21H21F2N5O3S |
|---|---|
| Molecular weight | 461.5 g/mol |
| IUPAC name | 5-[5-(3,3-difluoroazetidin-1-yl)-2-pyridinyl]-N-[3-(methanesulfonamido)phenyl]-1-methylpyrrole-3-carboxamide |
| InChIKey | NFDWKTIXFFIEAC-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=C1C2=NC=C(C=C2)N3CC(C3)(F)F)C(=O)NC4=CC(=CC=C4)NS(=O)(=O)C |
Computed by PubChem (NCBI)