CAS 2973754-88-8 is the registry number for Fmoc-L-Trp(1-Me,7-Cl)-OH. Offered by: Iris Biotech. Available pack sizes: on request.
(2S)-3-(7-chloro-1-methylindol-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 2973754-88-8) is a chemical compound with the molecular formula C27H23ClN2O4 and a molecular weight of 474.9 g/mol. IUPAC name: (2S)-3-(7-chloro-1-methylindol-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: WVUQZZXCDFVJDP-DEOSSOPVSA-N.
| Molecular formula | C27H23ClN2O4 |
|---|---|
| Molecular weight | 474.9 g/mol |
| IUPAC name | (2S)-3-(7-chloro-1-methylindol-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | WVUQZZXCDFVJDP-DEOSSOPVSA-N |
| SMILES | CN1C=C(C2=C1C(=CC=C2)Cl)C[C@@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)