CAS 29742-69-6 is the registry number for Epirubicin Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.
(7S,9S)-9-(2-bromoacetyl)-6,7,9,11-tetrahydroxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione (CAS 29742-69-6) is a chemical compound with the molecular formula C21H17BrO8 and a molecular weight of 477.3 g/mol. IUPAC name: (7S,9S)-9-(2-bromoacetyl)-6,7,9,11-tetrahydroxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione. InChIKey: JBZMHBHXHFZSMN-CWKPULSASA-N.
| Molecular formula | C21H17BrO8 |
|---|---|
| Molecular weight | 477.3 g/mol |
| IUPAC name | (7S,9S)-9-(2-bromoacetyl)-6,7,9,11-tetrahydroxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione |
| InChIKey | JBZMHBHXHFZSMN-CWKPULSASA-N |
| SMILES | COC1=CC=CC2=C1C(=O)C3=C(C4=C(C[C@](C[C@@H]4O)(C(=O)CBr)O)C(=C3C2=O)O)O |
Computed by PubChem (NCBI)