CAS 2975202-10-7 appears in our catalog under these names: N-Nitroso-ethyl-isopropylamine D5 (ethyl D5), N-Ethyl-N-nitrosopropan-2-amine-d5. Offered by: Dr. Ehrenstorfer, MedChemExpress. Available pack sizes: 10mg, Get quote.
N-(1,1,2,2,2-pentadeuterioethyl)-N-propan-2-ylnitrous amide (CAS 2975202-10-7) is a chemical compound with the molecular formula C5H12N2O and a molecular weight of 121.19 g/mol. IUPAC name: N-(1,1,2,2,2-pentadeuterioethyl)-N-propan-2-ylnitrous amide. InChIKey: VGGZTNNNXAUZLB-SGEUAGPISA-N.
| Molecular formula | C5H12N2O |
|---|---|
| Molecular weight | 121.19 g/mol |
| IUPAC name | N-(1,1,2,2,2-pentadeuterioethyl)-N-propan-2-ylnitrous amide |
| InChIKey | VGGZTNNNXAUZLB-SGEUAGPISA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])N(C(C)C)N=O |
Computed by PubChem (NCBI)