CAS 29761-21-5 appears in our catalog under these names: Isodecyl Diphenyl Phosphate, >95% (HPLC), Isodecyl Diphenyl Phosphate, 8-Methylnonyl diphenyl phosphate, Isodecyl diphenyl phosphate. Offered by: TRC, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 250mg, 50mg, 25 mg, 10 mg, 5 mg, 50 mg.
8-methylnonyl diphenyl phosphate (CAS 29761-21-5) is a chemical compound with the molecular formula C22H31O4P and a molecular weight of 390.5 g/mol. IUPAC name: 8-methylnonyl diphenyl phosphate. InChIKey: RYUJRXVZSJCHDZ-UHFFFAOYSA-N.
| Molecular formula | C22H31O4P |
|---|---|
| Molecular weight | 390.5 g/mol |
| IUPAC name | 8-methylnonyl diphenyl phosphate |
| InChIKey | RYUJRXVZSJCHDZ-UHFFFAOYSA-N |
| SMILES | CC(C)CCCCCCCOP(=O)(OC1=CC=CC=C1)OC2=CC=CC=C2 |
Computed by PubChem (NCBI)