CAS 2976497-48-8 is the registry number for PARP-1-IN-23. Offered by: MedChemExpress. Available pack sizes: Get quote.
[2-bromo-4-(4-carbamoyl-1H-benzimidazol-2-yl)-6-methoxyphenyl] 2-methylbenzenesulfonate (CAS 2976497-48-8) is a chemical compound with the molecular formula C22H18BrN3O5S and a molecular weight of 516.4 g/mol. IUPAC name: [2-bromo-4-(4-carbamoyl-1H-benzimidazol-2-yl)-6-methoxyphenyl] 2-methylbenzenesulfonate. InChIKey: FWZXLBLAODSAKH-UHFFFAOYSA-N.
| Molecular formula | C22H18BrN3O5S |
|---|---|
| Molecular weight | 516.4 g/mol |
| IUPAC name | [2-bromo-4-(4-carbamoyl-1H-benzimidazol-2-yl)-6-methoxyphenyl] 2-methylbenzenesulfonate |
| InChIKey | FWZXLBLAODSAKH-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1S(=O)(=O)OC2=C(C=C(C=C2Br)C3=NC4=C(C=CC=C4N3)C(=O)N)OC |
Computed by PubChem (NCBI)