Products 2977-51-7

CAS 2977-51-7 is the registry number for (2,3-Dichloro-4-(1-oxobutyl)phenoxy)-acetic Acid Ethyl Ester. Offered by: TRC. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

Ethyl 2-(4-butanoyl-2,3-dichlorophenoxy)acetate (CAS 2977-51-7) is a chemical compound with the molecular formula C14H16Cl2O4 and a molecular weight of 319.2 g/mol. IUPAC name: ethyl 2-(4-butanoyl-2,3-dichlorophenoxy)acetate. InChIKey: PBVGBFWAEFWKMK-UHFFFAOYSA-N.

Identity
Molecular formulaC14H16Cl2O4
Molecular weight319.2 g/mol
IUPAC nameethyl 2-(4-butanoyl-2,3-dichlorophenoxy)acetate
InChIKeyPBVGBFWAEFWKMK-UHFFFAOYSA-N
SMILESCCCC(=O)C1=C(C(=C(C=C1)OCC(=O)OCC)Cl)Cl

Computed by PubChem (NCBI)