CAS 2977-51-7 is the registry number for (2,3-Dichloro-4-(1-oxobutyl)phenoxy)-acetic Acid Ethyl Ester. Offered by: TRC. Available pack sizes: 5g.
Ethyl 2-(4-butanoyl-2,3-dichlorophenoxy)acetate (CAS 2977-51-7) is a chemical compound with the molecular formula C14H16Cl2O4 and a molecular weight of 319.2 g/mol. IUPAC name: ethyl 2-(4-butanoyl-2,3-dichlorophenoxy)acetate. InChIKey: PBVGBFWAEFWKMK-UHFFFAOYSA-N.
| Molecular formula | C14H16Cl2O4 |
|---|---|
| Molecular weight | 319.2 g/mol |
| IUPAC name | ethyl 2-(4-butanoyl-2,3-dichlorophenoxy)acetate |
| InChIKey | PBVGBFWAEFWKMK-UHFFFAOYSA-N |
| SMILES | CCCC(=O)C1=C(C(=C(C=C1)OCC(=O)OCC)Cl)Cl |
Computed by PubChem (NCBI)