CAS 297763-63-4 is the registry number for N-(3-bromophenyl)(3-chlorobenzo(b)thiophen-2-yl)formamide. Offered by: Biosynth. Available pack sizes: 5000mg.
N-(3-bromophenyl)-3-chloro-1-benzothiophene-2-carboxamide (CAS 297763-63-4) is a chemical compound with the molecular formula C15H9BrClNOS and a molecular weight of 366.7 g/mol. IUPAC name: N-(3-bromophenyl)-3-chloro-1-benzothiophene-2-carboxamide. InChIKey: CWRXJPOFTHKVNW-UHFFFAOYSA-N.
| Molecular formula | C15H9BrClNOS |
|---|---|
| Molecular weight | 366.7 g/mol |
| IUPAC name | N-(3-bromophenyl)-3-chloro-1-benzothiophene-2-carboxamide |
| InChIKey | CWRXJPOFTHKVNW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(S2)C(=O)NC3=CC(=CC=C3)Br)Cl |
Computed by PubChem (NCBI)