CAS 29786-44-5 appears in our catalog under these names: 1-(4-(Trifluoromethyl)phenyl)cyclobutanecarbonitrile, 95%, 1-(4-(Trifluoromethyl)phenyl)cyclobutanecarbonitrile, 98+%, 1-(4-(Trifluoromethyl)phenyl)-cyclobutanecarbonitrile. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 250mg, 1g, 10g, 0,5g.
1-[4-(trifluoromethyl)phenyl]cyclobutane-1-carbonitrile (CAS 29786-44-5) is a chemical compound with the molecular formula C12H10F3N and a molecular weight of 225.21 g/mol. IUPAC name: 1-[4-(trifluoromethyl)phenyl]cyclobutane-1-carbonitrile. InChIKey: MFKULHDHOJHBAX-UHFFFAOYSA-N.
| Molecular formula | C12H10F3N |
|---|---|
| Molecular weight | 225.21 g/mol |
| IUPAC name | 1-[4-(trifluoromethyl)phenyl]cyclobutane-1-carbonitrile |
| InChIKey | MFKULHDHOJHBAX-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C#N)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)