CAS 29804-18-0 appears in our catalog under these names: Rel-(3R,5S)-3,5-dimethylpiperidin-4-one hydrochloride, 98%, rac-(3R,5S)-3,5-Dimethylpiperidin-4-one hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
(3S,5R)-3,5-dimethylpiperidin-4-one;hydrochloride (CAS 29804-18-0) is a chemical compound with the molecular formula C7H14ClNO and a molecular weight of 163.64 g/mol. IUPAC name: (3S,5R)-3,5-dimethylpiperidin-4-one;hydrochloride. InChIKey: KGOSYMJHQHVVLJ-KNCHESJLSA-N.
| Molecular formula | C7H14ClNO |
|---|---|
| Molecular weight | 163.64 g/mol |
| IUPAC name | (3S,5R)-3,5-dimethylpiperidin-4-one;hydrochloride |
| InChIKey | KGOSYMJHQHVVLJ-KNCHESJLSA-N |
| SMILES | C[C@@H]1CNC[C@@H](C1=O)C.Cl |
Computed by PubChem (NCBI)