CAS 2982256-78-8 appears in our catalog under these names: CHI3L1–IN–1, CHI3L1-IN-1, 99.68%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 50 mg, 10 mg, 25 mg, 5 mg, 10mM/1mL, 100 mg.
(2S,5S)-5-[(4-chlorophenyl)methyl]-4-[1-(4-chloro-2-pyridinyl)piperidin-4-yl]-2-methylmorpholine (CAS 2982256-78-8) is a chemical compound with the molecular formula C22H27Cl2N3O and a molecular weight of 420.4 g/mol. IUPAC name: (2S,5S)-5-[(4-chlorophenyl)methyl]-4-[1-(4-chloro-2-pyridinyl)piperidin-4-yl]-2-methylmorpholine. InChIKey: GQUVGWGVUVRLTF-KKSFZXQISA-N.
| Molecular formula | C22H27Cl2N3O |
|---|---|
| Molecular weight | 420.4 g/mol |
| IUPAC name | (2S,5S)-5-[(4-chlorophenyl)methyl]-4-[1-(4-chloro-2-pyridinyl)piperidin-4-yl]-2-methylmorpholine |
| InChIKey | GQUVGWGVUVRLTF-KKSFZXQISA-N |
| SMILES | C[C@H]1CN([C@H](CO1)CC2=CC=C(C=C2)Cl)C3CCN(CC3)C4=NC=CC(=C4)Cl |
Computed by PubChem (NCBI)