Products 2982657-98-5
CAS 2982657-98-5 is the registry number for Antifungal agent 61. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-(1-benzothiophen-2-yl)-3-methylidene-4-(4-methylphenyl)oxolan-2-one (CAS 2982657-98-5) is a chemical compound with the molecular formula C20H16O2S and a molecular weight of 320.4 g/mol. IUPAC name: 5-(1-benzothiophen-2-yl)-3-methylidene-4-(4-methylphenyl)oxolan-2-one. InChIKey: UPNMURGBDVPTOH-UHFFFAOYSA-N.
| Molecular formula | C20H16O2S |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | 5-(1-benzothiophen-2-yl)-3-methylidene-4-(4-methylphenyl)oxolan-2-one |
| InChIKey | UPNMURGBDVPTOH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2C(OC(=O)C2=C)C3=CC4=CC=CC=C4S3 |
Computed by PubChem (NCBI)
Synonyms:
Antifungal agent 61