CAS 2982696-04-6 appears in our catalog under these names: PPARδ agonist 11, PPARδ agonist 11, 95%. Offered by: MedChemExpress, Ambeed. Available pack sizes: Get quote, 100mg, 250mg, 1g.
2-[2-methyl-4-[[5-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]methylsulfanyl]phenoxy]acetic acid (CAS 2982696-04-6) is a chemical compound with the molecular formula C19H15F3N2O3S2 and a molecular weight of 440.5 g/mol. IUPAC name: 2-[2-methyl-4-[[5-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]methylsulfanyl]phenoxy]acetic acid. InChIKey: NLJZRFBMZSIDNW-UHFFFAOYSA-N.
| Molecular formula | C19H15F3N2O3S2 |
|---|---|
| Molecular weight | 440.5 g/mol |
| IUPAC name | 2-[2-methyl-4-[[5-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]methylsulfanyl]phenoxy]acetic acid |
| InChIKey | NLJZRFBMZSIDNW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)SCC2=NN=C(S2)C3=CC=C(C=C3)C(F)(F)F)OCC(=O)O |
Computed by PubChem (NCBI)