CAS 2982696-34-2 is the registry number for PPARδ agonist 12. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[2-methyl-4-[[5-[4-(trifluoromethoxy)phenyl]-1,3,4-thiadiazol-2-yl]methylsulfanyl]phenoxy]acetic acid (CAS 2982696-34-2) is a chemical compound with the molecular formula C19H15F3N2O4S2 and a molecular weight of 456.5 g/mol. IUPAC name: 2-[2-methyl-4-[[5-[4-(trifluoromethoxy)phenyl]-1,3,4-thiadiazol-2-yl]methylsulfanyl]phenoxy]acetic acid. InChIKey: CUBNPKYXENIHPS-UHFFFAOYSA-N.
| Molecular formula | C19H15F3N2O4S2 |
|---|---|
| Molecular weight | 456.5 g/mol |
| IUPAC name | 2-[2-methyl-4-[[5-[4-(trifluoromethoxy)phenyl]-1,3,4-thiadiazol-2-yl]methylsulfanyl]phenoxy]acetic acid |
| InChIKey | CUBNPKYXENIHPS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)SCC2=NN=C(S2)C3=CC=C(C=C3)OC(F)(F)F)OCC(=O)O |
Computed by PubChem (NCBI)