Products 2982893-22-9
CAS 2982893-22-9 is the registry number for Tubulin polymerization-IN-48. Offered by: MedChemExpress. Available pack sizes: Get quote.
8-(3,5-dichloro-4-methoxyphenyl)-2-(4-methylphenyl)imidazo[1,2-a]pyrazine (CAS 2982893-22-9) is a chemical compound with the molecular formula C20H15Cl2N3O and a molecular weight of 384.3 g/mol. IUPAC name: 8-(3,5-dichloro-4-methoxyphenyl)-2-(4-methylphenyl)imidazo[1,2-a]pyrazine. InChIKey: LOQRRCBKTOIFLF-UHFFFAOYSA-N.
| Molecular formula | C20H15Cl2N3O |
|---|---|
| Molecular weight | 384.3 g/mol |
| IUPAC name | 8-(3,5-dichloro-4-methoxyphenyl)-2-(4-methylphenyl)imidazo[1,2-a]pyrazine |
| InChIKey | LOQRRCBKTOIFLF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CN3C=CN=C(C3=N2)C4=CC(=C(C(=C4)Cl)OC)Cl |
Computed by PubChem (NCBI)
Synonyms:
Tubulin polymerization-IN-48