CAS 2982920-37-4 is the registry number for 2-Ethyl-d5-toluene, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.
1-methyl-2-(1,1,2,2,2-pentadeuterioethyl)benzene (CAS 2982920-37-4) is a chemical compound with the molecular formula C9H12 and a molecular weight of 125.22 g/mol. IUPAC name: 1-methyl-2-(1,1,2,2,2-pentadeuterioethyl)benzene. InChIKey: HYFLWBNQFMXCPA-WNWXXORZSA-N.
| Molecular formula | C9H12 |
|---|---|
| Molecular weight | 125.22 g/mol |
| IUPAC name | 1-methyl-2-(1,1,2,2,2-pentadeuterioethyl)benzene |
| InChIKey | HYFLWBNQFMXCPA-WNWXXORZSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C1=CC=CC=C1C |
Computed by PubChem (NCBI)