Products 2983837-44-9
CAS 2983837-44-9 is the registry number for Docosapentaenoic acid (22n-3) (sodium). Offered by: MedChemExpress. Available pack sizes: 5 mg, 10 mg, 1 mg, 25 mg.
Sodium (7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoate (CAS 2983837-44-9) is a chemical compound with the molecular formula C22H33NaO2 and a molecular weight of 352.5 g/mol. IUPAC name: sodium (7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoate. InChIKey: UYPDYOYICMRNMO-RSDXMDNYSA-M.
| Molecular formula | C22H33NaO2 |
|---|---|
| Molecular weight | 352.5 g/mol |
| IUPAC name | sodium (7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoate |
| InChIKey | UYPDYOYICMRNMO-RSDXMDNYSA-M |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)