Products 2984527-72-0
CAS 2984527-72-0 is the registry number for tert-Butyl 4-(5-bromo-1,3,4-oxadiazol-2-yl)piperidine-1-carboxylate, 95%. Offered by: BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 5g.
Tert-butyl 4-(5-bromo-1,3,4-oxadiazol-2-yl)piperidine-1-carboxylate (CAS 2984527-72-0) is a chemical compound with the molecular formula C12H18BrN3O3 and a molecular weight of 332.19 g/mol. IUPAC name: tert-butyl 4-(5-bromo-1,3,4-oxadiazol-2-yl)piperidine-1-carboxylate. InChIKey: ITSWDNLITVFNBZ-UHFFFAOYSA-N.
| Molecular formula | C12H18BrN3O3 |
|---|---|
| Molecular weight | 332.19 g/mol |
| IUPAC name | tert-butyl 4-(5-bromo-1,3,4-oxadiazol-2-yl)piperidine-1-carboxylate |
| InChIKey | ITSWDNLITVFNBZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C2=NN=C(O2)Br |
Computed by PubChem (NCBI)