CAS 2985451-84-9 is the registry number for [(2R,5S)-5-Isopropylmorpholin-2-yl]methanol, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
[(2R,5S)-5-propan-2-ylmorpholin-2-yl]methanol (CAS 2985451-84-9) is a chemical compound with the molecular formula C8H17NO2 and a molecular weight of 159.23 g/mol. IUPAC name: [(2R,5S)-5-propan-2-ylmorpholin-2-yl]methanol. InChIKey: CVOMYDTZZZSIDP-HTQZYQBOSA-N.
| Molecular formula | C8H17NO2 |
|---|---|
| Molecular weight | 159.23 g/mol |
| IUPAC name | [(2R,5S)-5-propan-2-ylmorpholin-2-yl]methanol |
| InChIKey | CVOMYDTZZZSIDP-HTQZYQBOSA-N |
| SMILES | CC(C)[C@H]1CO[C@H](CN1)CO |
Computed by PubChem (NCBI)