Products 2986222-50-6
CAS 2986222-50-6 is the registry number for COX-2-IN-12. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-benzyl-3-(2-oxocyclohexyl)pyrrolidine-2,5-dione (CAS 2986222-50-6) is a chemical compound with the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. IUPAC name: 1-benzyl-3-(2-oxocyclohexyl)pyrrolidine-2,5-dione. InChIKey: VEXOJVXZKCAZML-UHFFFAOYSA-N.
| Molecular formula | C17H19NO3 |
|---|---|
| Molecular weight | 285.34 g/mol |
| IUPAC name | 1-benzyl-3-(2-oxocyclohexyl)pyrrolidine-2,5-dione |
| InChIKey | VEXOJVXZKCAZML-UHFFFAOYSA-N |
| SMILES | C1CCC(=O)C(C1)C2CC(=O)N(C2=O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)