Products 875702-37-7

CAS 875702-37-7 is the registry number for 3-[4-(4-Amino-phenoxy)-phenyl]-propionic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Ethyl 3-[4-(4-aminophenoxy)phenyl]propanoate (CAS 875702-37-7) is a chemical compound with the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. IUPAC name: ethyl 3-[4-(4-aminophenoxy)phenyl]propanoate. InChIKey: XHOZLZIZBUVKFO-UHFFFAOYSA-N.

Identity
Molecular formulaC17H19NO3
Molecular weight285.34 g/mol
IUPAC nameethyl 3-[4-(4-aminophenoxy)phenyl]propanoate
InChIKeyXHOZLZIZBUVKFO-UHFFFAOYSA-N
SMILESCCOC(=O)CCC1=CC=C(C=C1)OC2=CC=C(C=C2)N

Computed by PubChem (NCBI)