Products 298689-75-5

CAS 298689-75-5 is the registry number for Aminomethylboronic acid pinacol ester hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 250mg, 1g, 10g.

Structural formula: {0} (CAS {1})

(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanamine (CAS 298689-75-5) is a chemical compound with the molecular formula C7H16BNO2 and a molecular weight of 157.02 g/mol. IUPAC name: (4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanamine. InChIKey: KUPPDIFJIGRZOW-UHFFFAOYSA-N.

Identity
Molecular formulaC7H16BNO2
Molecular weight157.02 g/mol
IUPAC name(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanamine
InChIKeyKUPPDIFJIGRZOW-UHFFFAOYSA-N
SMILESB1(OC(C(O1)(C)C)(C)C)CN

Computed by PubChem (NCBI)