Products 2987135-92-0
CAS 2987135-92-0 is the registry number for SHP2-IN-9, 98.80%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 10mM/1mL, 100 mg, 50 mg, 10 mg, 5 mg.
N-[(4-fluorophenyl)methyl]-2-(3-oxo-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-4-yl)acetamide (CAS 2987135-92-0) is a chemical compound with the molecular formula C20H20FN3O2S and a molecular weight of 385.5 g/mol. IUPAC name: N-[(4-fluorophenyl)methyl]-2-(3-oxo-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-4-yl)acetamide. InChIKey: XMJVKWKUTXOIKU-UHFFFAOYSA-N.
| Molecular formula | C20H20FN3O2S |
|---|---|
| Molecular weight | 385.5 g/mol |
| IUPAC name | N-[(4-fluorophenyl)methyl]-2-(3-oxo-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-4-yl)acetamide |
| InChIKey | XMJVKWKUTXOIKU-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(CC1)SC3=C2C(=O)N(C=N3)CC(=O)NCC4=CC=C(C=C4)F |
Computed by PubChem (NCBI)