Products 607742-80-3
CAS 607742-80-3 is the registry number for GSK215083. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(3-fluorophenyl)sulfonyl-8-(4-methylpiperazin-1-yl)quinoline (CAS 607742-80-3) is a chemical compound with the molecular formula C20H20FN3O2S and a molecular weight of 385.5 g/mol. IUPAC name: 4-(3-fluorophenyl)sulfonyl-8-(4-methylpiperazin-1-yl)quinoline. InChIKey: XVIUHTAVQLTUGA-UHFFFAOYSA-N.
| Molecular formula | C20H20FN3O2S |
|---|---|
| Molecular weight | 385.5 g/mol |
| IUPAC name | 4-(3-fluorophenyl)sulfonyl-8-(4-methylpiperazin-1-yl)quinoline |
| InChIKey | XVIUHTAVQLTUGA-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CC=CC3=C(C=CN=C32)S(=O)(=O)C4=CC=CC(=C4)F |
Computed by PubChem (NCBI)