Products 2988096-59-7
CAS 2988096-59-7 appears in our catalog under these names: (R)-1-(4-Fluorophenyl)-2,2-dimethylpropan-1-amine hydrochloride, 95%, 95%, (R)-1-(4-Fluorophenyl)-2,2-dimethylpropan-1-amine hydrochloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(1R)-1-(4-fluorophenyl)-2,2-dimethylpropan-1-amine;hydrochloride (CAS 2988096-59-7) is a chemical compound with the molecular formula C11H17ClFN and a molecular weight of 217.71 g/mol. IUPAC name: (1R)-1-(4-fluorophenyl)-2,2-dimethylpropan-1-amine;hydrochloride. InChIKey: XVQIUQSTZIAYMN-PPHPATTJSA-N.
| Molecular formula | C11H17ClFN |
|---|---|
| Molecular weight | 217.71 g/mol |
| IUPAC name | (1R)-1-(4-fluorophenyl)-2,2-dimethylpropan-1-amine;hydrochloride |
| InChIKey | XVQIUQSTZIAYMN-PPHPATTJSA-N |
| SMILES | CC(C)(C)[C@H](C1=CC=C(C=C1)F)N.Cl |
Computed by PubChem (NCBI)