Products 2988880-65-3
CAS 2988880-65-3 is the registry number for (S)-2-Isopropyl-6-(4-phenyl-4,5-dihydrooxazol-2-yl)phenol, 98%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 50mg, 100mg, 250mg.
2-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]-6-propan-2-ylphenol (CAS 2988880-65-3) is a chemical compound with the molecular formula C18H19NO2 and a molecular weight of 281.3 g/mol. IUPAC name: 2-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]-6-propan-2-ylphenol. InChIKey: DIJFJPUYDGBLDE-MRXNPFEDSA-N.
| Molecular formula | C18H19NO2 |
|---|---|
| Molecular weight | 281.3 g/mol |
| IUPAC name | 2-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]-6-propan-2-ylphenol |
| InChIKey | DIJFJPUYDGBLDE-MRXNPFEDSA-N |
| SMILES | CC(C)C1=CC=CC(=C1O)C2=N[C@H](CO2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)