CAS 299-70-7 is the registry number for Rel-(2R,3R)-1,4-dibromobutane-2,3-diol, 98%. Offered by: AmBeed. Available pack sizes: 25g.
(2S,3S)-1,4-dibromobutane-2,3-diol (CAS 299-70-7) is a chemical compound with the molecular formula C4H8Br2O2 and a molecular weight of 247.91 g/mol. IUPAC name: (2S,3S)-1,4-dibromobutane-2,3-diol. InChIKey: XOWDQAHYPSENAC-QWWZWVQMSA-N.
| Molecular formula | C4H8Br2O2 |
|---|---|
| Molecular weight | 247.91 g/mol |
| IUPAC name | (2S,3S)-1,4-dibromobutane-2,3-diol |
| InChIKey | XOWDQAHYPSENAC-QWWZWVQMSA-N |
| SMILES | C([C@H]([C@@H](CBr)O)O)Br |
Computed by PubChem (NCBI)