CAS 299-95-6 appears in our catalog under these names: Dl-iso-proterenol hemisulfate dihydrate, 98%, Isoproterenol sulfate dihydrate, Isoprenaline sulphate dihydrate, Isoproterenol Sulfate Dihydrate, >98.0%(HPLC)(N), Isoprenaline hemisulfate. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Thermo Scientific (Acros). Available pack sizes: 5g, 1g, 25mg, 25g, 100g, Get quote.
Bis(4-[1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,2-diol);sulfuric acid (CAS 299-95-6) is a chemical compound with the molecular formula C22H36N2O10S and a molecular weight of 520.6 g/mol. IUPAC name: bis(4-[1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,2-diol);sulfuric acid. InChIKey: ZOLBALGTFCCTJF-UHFFFAOYSA-N.
| Molecular formula | C22H36N2O10S |
|---|---|
| Molecular weight | 520.6 g/mol |
| IUPAC name | bis(4-[1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,2-diol);sulfuric acid |
| InChIKey | ZOLBALGTFCCTJF-UHFFFAOYSA-N |
| SMILES | CC(C)NCC(C1=CC(=C(C=C1)O)O)O.CC(C)NCC(C1=CC(=C(C=C1)O)O)O.OS(=O)(=O)O |
Computed by PubChem (NCBI)