CAS 29900-31-0 is the registry number for cis-Crotoxyphos, >95% (HPLC). Offered by: TRC. Available pack sizes: 2,5g, 250mg.
1-phenylethyl (Z)-3-dimethoxyphosphoryloxybut-2-enoate (CAS 29900-31-0) is a chemical compound with the molecular formula C14H19O6P and a molecular weight of 314.27 g/mol. IUPAC name: 1-phenylethyl (Z)-3-dimethoxyphosphoryloxybut-2-enoate. InChIKey: XXXSILNSXNPGKG-KHPPLWFESA-N.
| Molecular formula | C14H19O6P |
|---|---|
| Molecular weight | 314.27 g/mol |
| IUPAC name | 1-phenylethyl (Z)-3-dimethoxyphosphoryloxybut-2-enoate |
| InChIKey | XXXSILNSXNPGKG-KHPPLWFESA-N |
| SMILES | CC(C1=CC=CC=C1)OC(=O)/C=C(/C)\OP(=O)(OC)OC |
Computed by PubChem (NCBI)