CAS 29900-93-4 is the registry number for (1R)-3-endo-Aminoborneol. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.
(1R,2R,3S,4S)-3-amino-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol (CAS 29900-93-4) is a chemical compound with the molecular formula C10H19NO and a molecular weight of 169.26 g/mol. IUPAC name: (1R,2R,3S,4S)-3-amino-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol. InChIKey: MDENRACGWNSYCU-VEVYYDQMSA-N.
| Molecular formula | C10H19NO |
|---|---|
| Molecular weight | 169.26 g/mol |
| IUPAC name | (1R,2R,3S,4S)-3-amino-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
| InChIKey | MDENRACGWNSYCU-VEVYYDQMSA-N |
| SMILES | C[C@@]12CC[C@@H](C1(C)C)[C@@H]([C@@H]2O)N |
Computed by PubChem (NCBI)