Products 2990549-73-8
CAS 2990549-73-8 is the registry number for Steroid sulfatase-IN-4. Offered by: MedChemExpress. Available pack sizes: Get quote.
[2-chloro-4-[5-[methyl-(2-methylphenyl)carbamoyl]furan-2-yl]phenyl] sulfamate (CAS 2990549-73-8) is a chemical compound with the molecular formula C19H17ClN2O5S and a molecular weight of 420.9 g/mol. IUPAC name: [2-chloro-4-[5-[methyl-(2-methylphenyl)carbamoyl]furan-2-yl]phenyl] sulfamate. InChIKey: FNMHDFLXMHWFAX-UHFFFAOYSA-N.
| Molecular formula | C19H17ClN2O5S |
|---|---|
| Molecular weight | 420.9 g/mol |
| IUPAC name | [2-chloro-4-[5-[methyl-(2-methylphenyl)carbamoyl]furan-2-yl]phenyl] sulfamate |
| InChIKey | FNMHDFLXMHWFAX-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1N(C)C(=O)C2=CC=C(O2)C3=CC(=C(C=C3)OS(=O)(=O)N)Cl |
Computed by PubChem (NCBI)
Synonyms:
Steroid sulfatase-IN-4