Products 2990549-94-3
CAS 2990549-94-3 is the registry number for Steroid sulfatase/17β-HSD1-IN-4. Offered by: MedChemExpress. Available pack sizes: Get quote.
[4-[4-[methyl-(2-methylphenyl)carbamoyl]-1,3-thiazol-2-yl]phenyl] sulfamate (CAS 2990549-94-3) is a chemical compound with the molecular formula C18H17N3O4S2 and a molecular weight of 403.5 g/mol. IUPAC name: [4-[4-[methyl-(2-methylphenyl)carbamoyl]-1,3-thiazol-2-yl]phenyl] sulfamate. InChIKey: OFOIBULGTCOPNO-UHFFFAOYSA-N.
| Molecular formula | C18H17N3O4S2 |
|---|---|
| Molecular weight | 403.5 g/mol |
| IUPAC name | [4-[4-[methyl-(2-methylphenyl)carbamoyl]-1,3-thiazol-2-yl]phenyl] sulfamate |
| InChIKey | OFOIBULGTCOPNO-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1N(C)C(=O)C2=CSC(=N2)C3=CC=C(C=C3)OS(=O)(=O)N |
Computed by PubChem (NCBI)
Synonyms:
Steroid sulfatase/17|A-HSD1-IN-4