CAS 2991-84-6 appears in our catalog under these names: Nonafluorobutanesulfonyl chloride, 95%, Nonafluorobutanesulfonyl chloride, 98% , NONAFLUORO-1-BUTANESULFONYL CHLORIDE, >&. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Sigma-Aldrich. Available pack sizes: 25g, 5g, 1g.
1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonyl chloride (CAS 2991-84-6) is a chemical compound with the molecular formula C4ClF9O2S and a molecular weight of 318.55 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonyl chloride. InChIKey: IRFCLLARAUQTNK-UHFFFAOYSA-N.
| Molecular formula | C4ClF9O2S |
|---|---|
| Molecular weight | 318.55 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonyl chloride |
| InChIKey | IRFCLLARAUQTNK-UHFFFAOYSA-N |
| SMILES | C(C(C(F)(F)S(=O)(=O)Cl)(F)F)(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)