Products 2991276-14-1
CAS 2991276-14-1 is the registry number for FXR agonist 15. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[4-[4-[(2,6-dichlorophenyl)sulfonyl-(2-methylpropyl)amino]phenyl]-2-fluorophenoxy]acetic acid (CAS 2991276-14-1) is a chemical compound with the molecular formula C24H22Cl2FNO5S and a molecular weight of 526.4 g/mol. IUPAC name: 2-[4-[4-[(2,6-dichlorophenyl)sulfonyl-(2-methylpropyl)amino]phenyl]-2-fluorophenoxy]acetic acid. InChIKey: NRHZDVWFLPAECO-UHFFFAOYSA-N.
| Molecular formula | C24H22Cl2FNO5S |
|---|---|
| Molecular weight | 526.4 g/mol |
| IUPAC name | 2-[4-[4-[(2,6-dichlorophenyl)sulfonyl-(2-methylpropyl)amino]phenyl]-2-fluorophenoxy]acetic acid |
| InChIKey | NRHZDVWFLPAECO-UHFFFAOYSA-N |
| SMILES | CC(C)CN(C1=CC=C(C=C1)C2=CC(=C(C=C2)OCC(=O)O)F)S(=O)(=O)C3=C(C=CC=C3Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
FXR agonist 15, orb3174288