CAS 2991637-98-8 is the registry number for DB008, 98.47%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 1 mg, 10mM/1mL, 5 mg, 25 mg.
6-ethynyl-4-[[4-fluoro-3-(4-prop-2-enoylpiperazine-1-carbonyl)phenyl]methyl]-2H-phthalazin-1-one (CAS 2991637-98-8) is a chemical compound with the molecular formula C25H21FN4O3 and a molecular weight of 444.5 g/mol. IUPAC name: 6-ethynyl-4-[[4-fluoro-3-(4-prop-2-enoylpiperazine-1-carbonyl)phenyl]methyl]-2H-phthalazin-1-one. InChIKey: FDHSVRMVJBTBMG-UHFFFAOYSA-N.
| Molecular formula | C25H21FN4O3 |
|---|---|
| Molecular weight | 444.5 g/mol |
| IUPAC name | 6-ethynyl-4-[[4-fluoro-3-(4-prop-2-enoylpiperazine-1-carbonyl)phenyl]methyl]-2H-phthalazin-1-one |
| InChIKey | FDHSVRMVJBTBMG-UHFFFAOYSA-N |
| SMILES | C=CC(=O)N1CCN(CC1)C(=O)C2=C(C=CC(=C2)CC3=NNC(=O)C4=C3C=C(C=C4)C#C)F |
Computed by PubChem (NCBI)