CAS 2992690-04-5 is the registry number for LSD1-IN-35. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-N,4-N-diethyl-1-N-[2-(4-methylsulfonylphenyl)quinazolin-4-yl]benzene-1,4-diamine (CAS 2992690-04-5) is a chemical compound with the molecular formula C25H26N4O2S and a molecular weight of 446.6 g/mol. IUPAC name: 4-N,4-N-diethyl-1-N-[2-(4-methylsulfonylphenyl)quinazolin-4-yl]benzene-1,4-diamine. InChIKey: RNALORNFLHWMDN-UHFFFAOYSA-N.
| Molecular formula | C25H26N4O2S |
|---|---|
| Molecular weight | 446.6 g/mol |
| IUPAC name | 4-N,4-N-diethyl-1-N-[2-(4-methylsulfonylphenyl)quinazolin-4-yl]benzene-1,4-diamine |
| InChIKey | RNALORNFLHWMDN-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC=C(C=C1)NC2=NC(=NC3=CC=CC=C32)C4=CC=C(C=C4)S(=O)(=O)C |
Computed by PubChem (NCBI)