CAS 299443-19-9 is the registry number for P0064. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-hydroxy-N-[(2-hydroxy-5-nitro-1H-indol-3-yl)imino]benzamide (CAS 299443-19-9) is a chemical compound with the molecular formula C15H10N4O5 and a molecular weight of 326.26 g/mol. IUPAC name: 2-hydroxy-N-[(2-hydroxy-5-nitro-1H-indol-3-yl)imino]benzamide. InChIKey: JQWQSZDXZGHMRX-UHFFFAOYSA-N.
| Molecular formula | C15H10N4O5 |
|---|---|
| Molecular weight | 326.26 g/mol |
| IUPAC name | 2-hydroxy-N-[(2-hydroxy-5-nitro-1H-indol-3-yl)imino]benzamide |
| InChIKey | JQWQSZDXZGHMRX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)N=NC2=C(NC3=C2C=C(C=C3)[N+](=O)[O-])O)O |
Computed by PubChem (NCBI)