CAS 2995272-75-6 is the registry number for Thalidomide-5-NH2-6-F. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-amino-2-(2,6-dioxopiperidin-3-yl)-6-fluoroisoindole-1,3-dione (CAS 2995272-75-6) is a chemical compound with the molecular formula C13H10FN3O4 and a molecular weight of 291.23 g/mol. IUPAC name: 5-amino-2-(2,6-dioxopiperidin-3-yl)-6-fluoroisoindole-1,3-dione. InChIKey: DGJWATREMIIRFK-UHFFFAOYSA-N.
| Molecular formula | C13H10FN3O4 |
|---|---|
| Molecular weight | 291.23 g/mol |
| IUPAC name | 5-amino-2-(2,6-dioxopiperidin-3-yl)-6-fluoroisoindole-1,3-dione |
| InChIKey | DGJWATREMIIRFK-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=CC(=C(C=C3C2=O)F)N |
Computed by PubChem (NCBI)