Products 2995274-58-1
CAS 2995274-58-1 is the registry number for (1-(5-Bromofuran-2-yl)cyclopropoxy)(tert-butyl)dimethylsilane, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[1-(5-bromofuran-2-yl)cyclopropyl]oxy-tert-butyl-dimethylsilane (CAS 2995274-58-1) is a chemical compound with the molecular formula C13H21BrO2Si and a molecular weight of 317.29 g/mol. IUPAC name: [1-(5-bromofuran-2-yl)cyclopropyl]oxy-tert-butyl-dimethylsilane. InChIKey: PNCZHMUIIXRYJF-UHFFFAOYSA-N.
| Molecular formula | C13H21BrO2Si |
|---|---|
| Molecular weight | 317.29 g/mol |
| IUPAC name | [1-(5-bromofuran-2-yl)cyclopropyl]oxy-tert-butyl-dimethylsilane |
| InChIKey | PNCZHMUIIXRYJF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1(CC1)C2=CC=C(O2)Br |
Computed by PubChem (NCBI)