CAS 1133116-37-6 appears in our catalog under these names: O-t-Butyldimethylsilyl 3-bromo-4-methoxyphenol, 98%, (3-Bromo-4-methoxyphenoxy)(tert-butyl)dimethylsilane, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
(3-bromo-4-methoxyphenoxy)-tert-butyl-dimethylsilane (CAS 1133116-37-6) is a chemical compound with the molecular formula C13H21BrO2Si and a molecular weight of 317.29 g/mol. IUPAC name: (3-bromo-4-methoxyphenoxy)-tert-butyl-dimethylsilane. InChIKey: KKBPSFFWSZBFER-UHFFFAOYSA-N.
| Molecular formula | C13H21BrO2Si |
|---|---|
| Molecular weight | 317.29 g/mol |
| IUPAC name | (3-bromo-4-methoxyphenoxy)-tert-butyl-dimethylsilane |
| InChIKey | KKBPSFFWSZBFER-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1=CC(=C(C=C1)OC)Br |
Computed by PubChem (NCBI)