CAS 2995293-11-1 is the registry number for 2-Boc-2-azabicyclo[2.2.1]hept-5-en-5-yl Trifluoromethanesulfonate, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 5-(trifluoromethylsulfonyloxy)-2-azabicyclo[2.2.1]hept-5-ene-2-carboxylate (CAS 2995293-11-1) is a chemical compound with the molecular formula C12H16F3NO5S and a molecular weight of 343.32 g/mol. IUPAC name: tert-butyl 5-(trifluoromethylsulfonyloxy)-2-azabicyclo[2.2.1]hept-5-ene-2-carboxylate. InChIKey: XHBRPRLHGZDJDS-UHFFFAOYSA-N.
| Molecular formula | C12H16F3NO5S |
|---|---|
| Molecular weight | 343.32 g/mol |
| IUPAC name | tert-butyl 5-(trifluoromethylsulfonyloxy)-2-azabicyclo[2.2.1]hept-5-ene-2-carboxylate |
| InChIKey | XHBRPRLHGZDJDS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2CC1C=C2OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)