CAS 2995300-60-0 is the registry number for DHFS-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[4-[(2,4-diaminopteridin-6-yl)methylamino]phenyl]-3-hydroxyazetidin-2-one (CAS 2995300-60-0) is a chemical compound with the molecular formula C16H16N8O2 and a molecular weight of 352.35 g/mol. IUPAC name: 3-[4-[(2,4-diaminopteridin-6-yl)methylamino]phenyl]-3-hydroxyazetidin-2-one. InChIKey: FMOVSMDIRZGDJJ-UHFFFAOYSA-N.
| Molecular formula | C16H16N8O2 |
|---|---|
| Molecular weight | 352.35 g/mol |
| IUPAC name | 3-[4-[(2,4-diaminopteridin-6-yl)methylamino]phenyl]-3-hydroxyazetidin-2-one |
| InChIKey | FMOVSMDIRZGDJJ-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)N1)(C2=CC=C(C=C2)NCC3=CN=C4C(=N3)C(=NC(=N4)N)N)O |
Computed by PubChem (NCBI)