CAS 2996-92-1 appears in our catalog under these names: Phenyltrimethoxysilane, 98%, Trimethoxyphenylsilane, Phenyltrimethoxysilane, 97% , Trimethoxyphenylsilane, >98.0%(GC), Phenyltrimethoxysilane, 85%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Thermo Scientific (Acros). Available pack sizes: 100g, 5g, 25g, 500ml, 500g, 25ml, 100ml, 1l.
Trimethoxy(phenyl)silane (CAS 2996-92-1) is a chemical compound with the molecular formula C9H14O3Si and a molecular weight of 198.29 g/mol. IUPAC name: trimethoxy(phenyl)silane. InChIKey: ZNOCGWVLWPVKAO-UHFFFAOYSA-N.
| Molecular formula | C9H14O3Si |
|---|---|
| Molecular weight | 198.29 g/mol |
| IUPAC name | trimethoxy(phenyl)silane |
| InChIKey | ZNOCGWVLWPVKAO-UHFFFAOYSA-N |
| SMILES | CO[Si](C1=CC=CC=C1)(OC)OC |
Computed by PubChem (NCBI)