CAS 2996864-57-2 is the registry number for JT21-25. Offered by: MedChemExpress. Available pack sizes: Get quote.
8-bromo-N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]quinoline-2-carboxamide (CAS 2996864-57-2) is a chemical compound with the molecular formula C20H17BrN6O and a molecular weight of 437.3 g/mol. IUPAC name: 8-bromo-N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]quinoline-2-carboxamide. InChIKey: MIQDXPCACSFZSH-UHFFFAOYSA-N.
| Molecular formula | C20H17BrN6O |
|---|---|
| Molecular weight | 437.3 g/mol |
| IUPAC name | 8-bromo-N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]quinoline-2-carboxamide |
| InChIKey | MIQDXPCACSFZSH-UHFFFAOYSA-N |
| SMILES | CC(C)N1C=NN=C1C2=NC(=CC=C2)NC(=O)C3=NC4=C(C=CC=C4Br)C=C3 |
Computed by PubChem (NCBI)