CAS 2998932-98-0 is the registry number for HDAC6-IN-59. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[[[5-(4-chlorophenyl)-2-phenyl-1,2,4-triazol-3-yl]amino]methyl]-N-hydroxybenzamide (CAS 2998932-98-0) is a chemical compound with the molecular formula C22H18ClN5O2 and a molecular weight of 419.9 g/mol. IUPAC name: 4-[[[5-(4-chlorophenyl)-2-phenyl-1,2,4-triazol-3-yl]amino]methyl]-N-hydroxybenzamide. InChIKey: YZXLTXWSFDEBPH-UHFFFAOYSA-N.
| Molecular formula | C22H18ClN5O2 |
|---|---|
| Molecular weight | 419.9 g/mol |
| IUPAC name | 4-[[[5-(4-chlorophenyl)-2-phenyl-1,2,4-triazol-3-yl]amino]methyl]-N-hydroxybenzamide |
| InChIKey | YZXLTXWSFDEBPH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=NC(=N2)C3=CC=C(C=C3)Cl)NCC4=CC=C(C=C4)C(=O)NO |
Computed by PubChem (NCBI)