CAS 2998940-98-8 is the registry number for Urease-IN-20. Offered by: MedChemExpress. Available pack sizes: Get quote.
1,2-benzoselenazol-3-yl 3-fluorobenzoate (CAS 2998940-98-8) is a chemical compound with the molecular formula C14H8FNO2Se and a molecular weight of 320.19 g/mol. IUPAC name: 1,2-benzoselenazol-3-yl 3-fluorobenzoate. InChIKey: NJBQRZVSBXKMIM-UHFFFAOYSA-N.
| Molecular formula | C14H8FNO2Se |
|---|---|
| Molecular weight | 320.19 g/mol |
| IUPAC name | 1,2-benzoselenazol-3-yl 3-fluorobenzoate |
| InChIKey | NJBQRZVSBXKMIM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=N[Se]2)OC(=O)C3=CC(=CC=C3)F |
Computed by PubChem (NCBI)