CAS 299929-71-8 is the registry number for N2-(tert-Butyl)-6-chloro-N4,N4-dimethyl-1,3,5-triazine-2,4-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-N-tert-butyl-6-chloro-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine (CAS 299929-71-8) is a chemical compound with the molecular formula C9H16ClN5 and a molecular weight of 229.71 g/mol. IUPAC name: 4-N-tert-butyl-6-chloro-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine. InChIKey: AKAZTQKGNFIPHF-UHFFFAOYSA-N.
| Molecular formula | C9H16ClN5 |
|---|---|
| Molecular weight | 229.71 g/mol |
| IUPAC name | 4-N-tert-butyl-6-chloro-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
| InChIKey | AKAZTQKGNFIPHF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC1=NC(=NC(=N1)Cl)N(C)C |
Computed by PubChem (NCBI)