CAS 299933-60-1 is the registry number for 5-(3,5-Bis(trifluoromethyl)benzyl)-1,3,4-thiadiazol-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1,3,4-thiadiazol-2-amine (CAS 299933-60-1) is a chemical compound with the molecular formula C11H7F6N3S and a molecular weight of 327.25 g/mol. IUPAC name: 5-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1,3,4-thiadiazol-2-amine. InChIKey: HZYLEVSVBRVKPL-UHFFFAOYSA-N.
| Molecular formula | C11H7F6N3S |
|---|---|
| Molecular weight | 327.25 g/mol |
| IUPAC name | 5-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1,3,4-thiadiazol-2-amine |
| InChIKey | HZYLEVSVBRVKPL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)CC2=NN=C(S2)N |
Computed by PubChem (NCBI)