Products 299935-34-5

CAS 299935-34-5 is the registry number for Disodium 9h-fluorene-2,7-disulfonate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 25g, 1g.

Structural formula: {0} (CAS {1})

9H-fluorene-2,7-disulfonate (CAS 299935-34-5) is a chemical compound with the molecular formula C13H8O6S2-2 and a molecular weight of 324.3 g/mol. IUPAC name: 9H-fluorene-2,7-disulfonate. InChIKey: WBJRJWHBYUAEQD-UHFFFAOYSA-L.

Identity
Molecular formulaC13H8O6S2-2
Molecular weight324.3 g/mol
IUPAC name9H-fluorene-2,7-disulfonate
InChIKeyWBJRJWHBYUAEQD-UHFFFAOYSA-L
SMILESC1C2=C(C=CC(=C2)S(=O)(=O)[O-])C3=C1C=C(C=C3)S(=O)(=O)[O-]

Computed by PubChem (NCBI)