CAS 299937-35-2 is the registry number for 5-(9H-Fluoren-9-yl)-1,3,4-thiadiazol-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(9H-fluoren-9-yl)-1,3,4-thiadiazol-2-amine (CAS 299937-35-2) is a chemical compound with the molecular formula C15H11N3S and a molecular weight of 265.3 g/mol. IUPAC name: 5-(9H-fluoren-9-yl)-1,3,4-thiadiazol-2-amine. InChIKey: SWSHUIMWMMWISN-UHFFFAOYSA-N.
| Molecular formula | C15H11N3S |
|---|---|
| Molecular weight | 265.3 g/mol |
| IUPAC name | 5-(9H-fluoren-9-yl)-1,3,4-thiadiazol-2-amine |
| InChIKey | SWSHUIMWMMWISN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)C4=NN=C(S4)N |
Computed by PubChem (NCBI)